C32H64N2O9 — CID 11814168
(2R,3S,4S,5R,6R)-2-[(decylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(decylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol (PubChem CID 11814168) has the molecular formula C32H64N2O9 and a molecular weight of 620.87 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[(decylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(decylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[(decylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(decylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11814168 |
| Molecular Formula | C32H64N2O9 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.46 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[(decylamino)methyl]-6-[(2R,3R,4S,5S,6R)-6-[(decylamino)methyl]-3,4,5-trihydroxyoxan-2-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCCCNC[C@H]1O[C@H](O[C@H]2O[C@H](CNCCCCCCCCCC)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H64N2O9/c1-3-5-7-9-11-13-15-17-19-33-21-23-25(35)27(37)29(39)31(41-23)43-32-30(40)28(38)26(36)24(42-32)22-34-20-18-16-14-12-10-8-6-4-2/h23-40H,3-22H2,1-2H3/t23-,24-,25-,26-,27+,28+,29-,30-,31-,32-/m1/s1 |
| InChIKey | PCZBQLPGUVFJAB-HNGBAHPMSA-N |
| XLogP | 2.08 |
| TPSA | 173.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|