C11H13F3N6 — CID 118142282
3-methyl-6-(4,4,4-trifluorobutyl)-2H-pyrazolo[3,4-d]pyrimidine-4-carboximidamide (PubChem CID 118142282) has the molecular formula C11H13F3N6 and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-methyl-6-(4,4,4-trifluorobutyl)-2H-pyrazolo[3,4-d]pyrimidine-4-carboximidamide.
| Compound Name | 3-methyl-6-(4,4,4-trifluorobutyl)-2H-pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 118142282 |
| Molecular Formula | C11H13F3N6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-methyl-6-(4,4,4-trifluorobutyl)-2H-pyrazolo[3,4-d]pyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1nc(CCCC(F)(F)F)nc2n[nH]c(C)c12 |
| InChI | InChI=1S/C11H13F3N6/c1-5-7-8(9(15)16)17-6(18-10(7)20-19-5)3-2-4-11(12,13)14/h2-4H2,1H3,(H3,15,16)(H,17,18,19,20) |
| InChIKey | IIRPNHFYZUKWEJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|