About ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate
ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate (PubChem CID 118142334) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate |
| PubChem CID | 118142334 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate |
| SMILES | CCOC(=O)C(C)c1nnc(C2CC2)o1 |
| InChI | InChI=1S/C10H14N2O3/c1-3-14-10(13)6(2)8-11-12-9(15-8)7-4-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | BOZPMGQIGJVBNJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The IUPAC name of ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate (CID 118142334) is ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate.
What is the SMILES notation for ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The canonical SMILES for ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate is CCOC(=O)C(C)c1nnc(C2CC2)o1.
What is the InChIKey of ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
The InChIKey is BOZPMGQIGJVBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-3-14-10(13)6(2)8-11-12-9(15-8)7-4-5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate?
ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate has a molecular weight of 210.23 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)propanoate is sourced from PubChem (CID 118142334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).