C23H20F5N9O2 — CID 118142349
4-amino-5-(5-methoxy-2-pyridinyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 118142349) has the molecular formula C23H20F5N9O2 and a molecular weight of 552.48 g/mol. Its IUPAC name is 4-amino-5-(5-methoxy-2-pyridinyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-5-(5-methoxy-2-pyridinyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 118142349 |
| Molecular Formula | C23H20F5N9O2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-amino-5-(5-methoxy-2-pyridinyl)-5-methyl-2-[6-(3,3,4,4,4-pentafluorobutyl)-1-(trideuteriomethyl)pyrazolo[3,4-d]pyrimidin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | [2H]C([2H])([2H])n1ncc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)c3ccc(OC)cn3)nc(CCC(F)(F)C(F)(F)F)nc21 |
| InChI | InChI=1S/C23H20F5N9O2/c1-21(12-5-4-10(39-3)8-30-12)14-16(29)34-18(35-17(14)36-20(21)38)15-11-9-31-37(2)19(11)33-13(32-15)6-7-22(24,25)23(26,27)28/h4-5,8-9H,6-7H2,1-3H3,(H3,29,34,35,36,38)/i2D3 |
| InChIKey | OHGOVVDAAIEEDK-BMSJAHLVSA-N |
| XLogP | 3.19 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|