About 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one
3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one (PubChem CID 118142930) has the molecular formula C8H6ClNO
and a molecular weight of 167.59 g/mol. Its IUPAC name is 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one.
Molecular Properties
| Compound Name | 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one |
| PubChem CID | 118142930 |
| Molecular Formula | C8H6ClNO |
| Molecular Weight | 167.59 g/mol |
| Exact Mass | 167.01 |
| IUPAC Name | 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one |
| SMILES | O=C1CCc2cc(Cl)ncc21 |
| InChI | InChI=1S/C8H6ClNO/c9-8-3-5-1-2-7(11)6(5)4-10-8/h3-4H,1-2H2 |
| InChIKey | IFLYOMGKTMVBHU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one?
The IUPAC name of 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one (CID 118142930) is 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one.
What is the SMILES notation for 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one?
The canonical SMILES for 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one is O=C1CCc2cc(Cl)ncc21.
What is the InChIKey of 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one?
The InChIKey is IFLYOMGKTMVBHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO/c9-8-3-5-1-2-7(11)6(5)4-10-8/h3-4H,1-2H2.
What are the key properties of 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one?
3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one has a molecular weight of 167.59 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-dihydrocyclopenta[c]pyridin-7-one is sourced from PubChem (CID 118142930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).