C33H60N2O3 — CID 118143180
(2S)-2,6-diaminohexanoic acid;(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118143180) has the molecular formula C33H60N2O3 and a molecular weight of 532.85 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (2S)-2,6-diaminohexanoic acid;(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118143180 |
| Molecular Formula | C33H60N2O3 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.46 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C27H46O.C6H14N2O2/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5;7-4-2-1-3-5(8)6(9)10/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3;5H,1-4,7-8H2,(H,9,10)/t19-,21+,22+,23-,24+,25+,26+,27-;5-/m10/s1 |
| InChIKey | ILLCRNGXBQVHCK-ZJFZQWIOSA-N |
| XLogP | 6.92 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|