About 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine
6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine (PubChem CID 118143193) has the molecular formula C7H3BrClF2NO2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine |
| PubChem CID | 118143193 |
| Molecular Formula | C7H3BrClF2NO2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 284.90 |
| IUPAC Name | 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine |
| SMILES | Nc1cc2c(c(Cl)c1Br)OC(F)(F)O2 |
| InChI | InChI=1S/C7H3BrClF2NO2/c8-4-2(12)1-3-6(5(4)9)14-7(10,11)13-3/h1H,12H2 |
| InChIKey | BXILDYPMLHIJDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine?
The IUPAC name of 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine (CID 118143193) is 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine.
What is the SMILES notation for 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine?
The canonical SMILES for 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine is Nc1cc2c(c(Cl)c1Br)OC(F)(F)O2.
What is the InChIKey of 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine?
The InChIKey is BXILDYPMLHIJDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClF2NO2/c8-4-2(12)1-3-6(5(4)9)14-7(10,11)13-3/h1H,12H2.
What are the key properties of 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine?
6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine has a molecular weight of 286.46 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-chloro-2,2-difluoro-1,3-benzodioxol-5-amine is sourced from PubChem (CID 118143193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).