C11H15NO — CID 118143620
5,5-dimethyl-1,6,7,8-tetrahydroquinolin-2-one (PubChem CID 118143620) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5,5-dimethyl-1,6,7,8-tetrahydroquinolin-2-one.
| Compound Name | 5,5-dimethyl-1,6,7,8-tetrahydroquinolin-2-one |
|---|---|
| PubChem CID | 118143620 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5,5-dimethyl-1,6,7,8-tetrahydroquinolin-2-one |
| SMILES | CC1(C)CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C11H15NO/c1-11(2)7-3-4-9-8(11)5-6-10(13)12-9/h5-6H,3-4,7H2,1-2H3,(H,12,13) |
| InChIKey | QQDWAXNDJBLACH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |