About 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine
3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine (PubChem CID 118143777) has the molecular formula C14H11Cl4N5
and a molecular weight of 391.09 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine.
Molecular Properties
| Compound Name | 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine |
| PubChem CID | 118143777 |
| Molecular Formula | C14H11Cl4N5 |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(c1cc(Cl)cc(Cl)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H11Cl4N5/c15-7-1-8(16)4-11(3-7)23(14(21)22-13(19)20)12-5-9(17)2-10(18)6-12/h1-6H,(H5,19,20,21,22) |
| InChIKey | RQEDXESTSSHEHD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine?
The IUPAC name of 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine (CID 118143777) is 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine.
What is the SMILES notation for 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine?
The canonical SMILES for 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine is [H]/N=C(\N=C(N)N)N(c1cc(Cl)cc(Cl)c1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine?
The InChIKey is RQEDXESTSSHEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl4N5/c15-7-1-8(16)4-11(3-7)23(14(21)22-13(19)20)12-5-9(17)2-10(18)6-12/h1-6H,(H5,19,20,21,22).
What are the key properties of 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine?
3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine has a molecular weight of 391.09 g/mol, XLogP of 4.65, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylidene)-1,1-bis(3,5-dichlorophenyl)guanidine is sourced from PubChem (CID 118143777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).