C34H50N10O4 — CID 11814379
1-N,4-N-bis[5-[(3-amino-3-iminopropyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]cyclohexa-1,3-diene-1,4-dicarboxamide (PubChem CID 11814379) has the molecular formula C34H50N10O4 and a molecular weight of 662.84 g/mol. Its IUPAC name is 1-N,4-N-bis[5-[(3-amino-3-iminopropyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]cyclohexa-1,3-diene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[5-[(3-amino-3-iminopropyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]cyclohexa-1,3-diene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 11814379 |
| Molecular Formula | C34H50N10O4 |
| Molecular Weight | 662.84 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 1-N,4-N-bis[5-[(3-amino-3-iminopropyl)carbamoyl]-1-(3-methylbutyl)pyrrol-3-yl]cyclohexa-1,3-diene-1,4-dicarboxamide |
| SMILES | [H]/N=C(\N)CCNC(=O)c1cc(NC(=O)C2=CC=C(C(=O)Nc3cc(C(=O)NCC/C(N)=N/[H])n(CCC(C)C)c3)CC2)cn1CCC(C)C |
| InChI | InChI=1S/C34H50N10O4/c1-21(2)11-15-43-19-25(17-27(43)33(47)39-13-9-29(35)36)41-31(45)23-5-7-24(8-6-23)32(46)42-26-18-28(34(48)40-14-10-30(37)38)44(20-26)16-12-22(3)4/h5,7,17-22H,6,8-16H2,1-4H3,(H3,35,36)(H3,37,38)(H,39,47)(H,40,48)(H,41,45)(H,42,46) |
| InChIKey | ITBGRHABABCKSZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 226.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|