C13H24N2O3 — CID 118143811
4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butanoate (PubChem CID 118143811) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butanoate.
| Compound Name | 4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 118143811 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-[dimethyl-[3-(2-methylprop-2-enoylamino)propyl]azaniumyl]butanoate |
| SMILES | C=C(C)C(=O)NCCC[N+](C)(C)CCCC(=O)[O-] |
| InChI | InChI=1S/C13H24N2O3/c1-11(2)13(18)14-8-6-10-15(3,4)9-5-7-12(16)17/h1,5-10H2,2-4H3,(H-,14,16,17,18) |
| InChIKey | TWVNMLBBZVLMKF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|