C35H47ClO7SSi — CID 11814431
[(E,2R,3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] chloromethanesulfonate (PubChem CID 11814431) has the molecular formula C35H47ClO7SSi and a molecular weight of 675.36 g/mol. Its IUPAC name is [(E,2R,3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] chloromethanesulfonate.
| Compound Name | [(E,2R,3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] chloromethanesulfonate |
|---|---|
| PubChem CID | 11814431 |
| Molecular Formula | C35H47ClO7SSi |
| Molecular Weight | 675.36 g/mol |
| Exact Mass | 674.25 |
| IUPAC Name | [(E,2R,3S,4R)-7-[tert-butyl(dimethyl)silyl]oxy-1,3,4-tris(phenylmethoxy)hept-5-en-2-yl] chloromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(=O)(=O)CCl |
| InChI | InChI=1S/C35H47ClO7SSi/c1-35(2,3)45(4,5)42-23-15-22-32(40-25-30-18-11-7-12-19-30)34(41-26-31-20-13-8-14-21-31)33(43-44(37,38)28-36)27-39-24-29-16-9-6-10-17-29/h6-22,32-34H,23-28H2,1-5H3/b22-15+/t32-,33-,34+/m1/s1 |
| InChIKey | UGNMWFBMQSLRBV-BEMALCCASA-N |
| XLogP | 7.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.36 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|