C21H18F9NO4S — CID 118144352
2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]phenyl]acetamide (PubChem CID 118144352) has the molecular formula C21H18F9NO4S and a molecular weight of 551.43 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 118144352 |
| Molecular Formula | C21H18F9NO4S |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-[1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propan-2-yl]phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F9NO4S/c1-2-36(33,34)16-9-3-13(4-10-16)11-17(32)31-15-7-5-14(6-8-15)19(20(25,26)27,21(28,29)30)35-12-18(22,23)24/h3-10H,2,11-12H2,1H3,(H,31,32) |
| InChIKey | MZXCZSSOZYRXOH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |