C18H25ClN4O6S — CID 118144669
2-[[(3aR,4S,6aS)-6-[(6-chloro-5-formamido-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid (PubChem CID 118144669) has the molecular formula C18H25ClN4O6S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-formamido-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid.
| Compound Name | 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-formamido-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 118144669 |
| Molecular Formula | C18H25ClN4O6S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-[[(3aR,4S,6aS)-6-[(6-chloro-5-formamido-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]acetic acid |
| SMILES | CCCSc1nc(Cl)c(NC=O)c(NC2C[C@H](OCC(=O)O)[C@H]3OC(C)(C)O[C@@H]23)n1 |
| InChI | InChI=1S/C18H25ClN4O6S/c1-4-5-30-17-22-15(19)12(20-8-24)16(23-17)21-9-6-10(27-7-11(25)26)14-13(9)28-18(2,3)29-14/h8-10,13-14H,4-7H2,1-3H3,(H,20,24)(H,25,26)(H,21,22,23)/t9?,10-,13-,14+/m0/s1 |
| InChIKey | NQBSZRUBNRUFSH-ULLNTPICSA-N |
| XLogP | 2.37 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|