C39H44N8O4 — CID 11814469
1-[2-(dimethylamino)ethylamino]-N-[3-[[1-[2-(dimethylamino)ethylamino]-9-oxo-10H-acridine-4-carbonyl]amino]propyl]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 11814469) has the molecular formula C39H44N8O4 and a molecular weight of 688.83 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethylamino]-N-[3-[[1-[2-(dimethylamino)ethylamino]-9-oxo-10H-acridine-4-carbonyl]amino]propyl]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | 1-[2-(dimethylamino)ethylamino]-N-[3-[[1-[2-(dimethylamino)ethylamino]-9-oxo-10H-acridine-4-carbonyl]amino]propyl]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 11814469 |
| Molecular Formula | C39H44N8O4 |
| Molecular Weight | 688.83 g/mol |
| Exact Mass | 688.35 |
| IUPAC Name | 1-[2-(dimethylamino)ethylamino]-N-[3-[[1-[2-(dimethylamino)ethylamino]-9-oxo-10H-acridine-4-carbonyl]amino]propyl]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | CN(C)CCNc1ccc(C(=O)NCCCNC(=O)c2ccc(NCCN(C)C)c3c(=O)c4ccccc4[nH]c23)c2[nH]c3ccccc3c(=O)c12 |
| InChI | InChI=1S/C39H44N8O4/c1-46(2)22-20-40-30-16-14-26(34-32(30)36(48)24-10-5-7-12-28(24)44-34)38(50)42-18-9-19-43-39(51)27-15-17-31(41-21-23-47(3)4)33-35(27)45-29-13-8-6-11-25(29)37(33)49/h5-8,10-17,40-41H,9,18-23H2,1-4H3,(H,42,50)(H,43,51)(H,44,48)(H,45,49) |
| InChIKey | VKRRAAADEMZBOL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.83 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|