C16H20BrNO2 — CID 118144851
(2E,4Z,6E)-N-(4-bromobutyl)-N-prop-2-enoylnona-2,4,6,8-tetraenamide (PubChem CID 118144851) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is (2E,4Z,6E)-N-(4-bromobutyl)-N-prop-2-enoylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4Z,6E)-N-(4-bromobutyl)-N-prop-2-enoylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 118144851 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2E,4Z,6E)-N-(4-bromobutyl)-N-prop-2-enoylnona-2,4,6,8-tetraenamide |
| SMILES | C=C/C=C/C=C\C=C\C(=O)N(CCCCBr)C(=O)C=C |
| InChI | InChI=1S/C16H20BrNO2/c1-3-5-6-7-8-9-12-16(20)18(15(19)4-2)14-11-10-13-17/h3-9,12H,1-2,10-11,13-14H2/b6-5+,8-7-,12-9+ |
| InChIKey | JIOMLPNFWBQDSU-WXJJSUKMSA-N |
| XLogP | 3.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|