C35H56O9SSi2 — CID 11814532
[(1S,5S,6R,7S,10R,12S,13S,15R)-13,17,20,20-tetramethyl-3,14,18-trioxo-12,15-bis(triethylsilyloxy)-2,4-dioxa-9-thiapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate (PubChem CID 11814532) has the molecular formula C35H56O9SSi2 and a molecular weight of 709.06 g/mol. Its IUPAC name is [(1S,5S,6R,7S,10R,12S,13S,15R)-13,17,20,20-tetramethyl-3,14,18-trioxo-12,15-bis(triethylsilyloxy)-2,4-dioxa-9-thiapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate.
| Compound Name | [(1S,5S,6R,7S,10R,12S,13S,15R)-13,17,20,20-tetramethyl-3,14,18-trioxo-12,15-bis(triethylsilyloxy)-2,4-dioxa-9-thiapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
|---|---|
| PubChem CID | 11814532 |
| Molecular Formula | C35H56O9SSi2 |
| Molecular Weight | 709.06 g/mol |
| Exact Mass | 708.32 |
| IUPAC Name | [(1S,5S,6R,7S,10R,12S,13S,15R)-13,17,20,20-tetramethyl-3,14,18-trioxo-12,15-bis(triethylsilyloxy)-2,4-dioxa-9-thiapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-7-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C(=O)[C@]2(C)[C@@H](O[Si](CC)(CC)CC)C[C@H]3SC[C@@]3(OC(C)=O)[C@H]2[C@@H]2OC(=O)O[C@]23CC(=O)C(C)=C1C3(C)C |
| InChI | InChI=1S/C35H56O9SSi2/c1-12-46(13-2,14-3)43-24-18-25-34(20-45-25,41-22(8)36)28-30-35(42-31(39)40-30)19-23(37)21(7)26(32(35,9)10)27(29(38)33(24,28)11)44-47(15-4,16-5)17-6/h24-25,27-28,30H,12-20H2,1-11H3/t24-,25+,27+,28-,30-,33+,34-,35+/m0/s1 |
| InChIKey | CTVOYTWVFAZBPX-DMOTUGQFSA-N |
| XLogP | 7.38 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.06 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|