About propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate
propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate (PubChem CID 118145589) has the molecular formula C25H31FN4O2
and a molecular weight of 438.55 g/mol. Its IUPAC name is propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate.
Molecular Properties
| Compound Name | propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate |
| PubChem CID | 118145589 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC23CC4CC(CC(C4)C2)C3)c(NC(F)c2cncnc2)c1 |
| InChI | InChI=1S/C25H31FN4O2/c1-15(2)32-24(31)19-3-4-21(22(8-19)29-23(26)20-12-27-14-28-13-20)30-25-9-16-5-17(10-25)7-18(6-16)11-25/h3-4,8,12-18,23,29-30H,5-7,9-11H2,1-2H3 |
| InChIKey | CWCNRMDCDCJABS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate?
The IUPAC name of propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate (CID 118145589) is propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate.
What is the SMILES notation for propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate?
The canonical SMILES for propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate is CC(C)OC(=O)c1ccc(NC23CC4CC(CC(C4)C2)C3)c(NC(F)c2cncnc2)c1.
What is the InChIKey of propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate?
The InChIKey is CWCNRMDCDCJABS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31FN4O2/c1-15(2)32-24(31)19-3-4-21(22(8-19)29-23(26)20-12-27-14-28-13-20)30-25-9-16-5-17(10-25)7-18(6-16)11-25/h3-4,8,12-18,23,29-30H,5-7,9-11H2,1-2H3.
What are the key properties of propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate?
propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate has a molecular weight of 438.55 g/mol, XLogP of 5.50, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-(1-adamantylamino)-3-[[fluoro(pyrimidin-5-yl)methyl]amino]benzoate is sourced from PubChem (CID 118145589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).