C44H60O5SSi — CID 11814594
bis(prop-2-enyl) 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl]-2-heptylpropanedioate (PubChem CID 11814594) has the molecular formula C44H60O5SSi and a molecular weight of 729.11 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl]-2-heptylpropanedioate.
| Compound Name | bis(prop-2-enyl) 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl]-2-heptylpropanedioate |
|---|---|
| PubChem CID | 11814594 |
| Molecular Formula | C44H60O5SSi |
| Molecular Weight | 729.11 g/mol |
| Exact Mass | 728.39 |
| IUPAC Name | bis(prop-2-enyl) 2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-tritylsulfanylpropyl]-2-heptylpropanedioate |
| SMILES | C=CCOC(=O)C(CCCCCCC)(C[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)O[Si](C)(C)C(C)(C)C)C(=O)OCC=C |
| InChI | InChI=1S/C44H60O5SSi/c1-9-12-13-14-24-31-43(40(45)47-32-10-2,41(46)48-33-11-3)34-39(49-51(7,8)42(4,5)6)35-50-44(36-25-18-15-19-26-36,37-27-20-16-21-28-37)38-29-22-17-23-30-38/h10-11,15-23,25-30,39H,2-3,9,12-14,24,31-35H2,1,4-8H3/t39-/m0/s1 |
| InChIKey | LTYBPSKBLZCRSP-KDXMTYKHSA-N |
| XLogP | 11.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.11 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|