C24H21FN8O — CID 118146078
4-[12-[(4-fluorophenyl)methyl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118146078) has the molecular formula C24H21FN8O and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-[12-[(4-fluorophenyl)methyl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-[12-[(4-fluorophenyl)methyl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118146078 |
| Molecular Formula | C24H21FN8O |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-[12-[(4-fluorophenyl)methyl]-9-oxa-2,3,13-triazatricyclo[6.4.1.04,13]trideca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(Cc2ccc(F)cc2)CCO3)n1 |
| InChI | InChI=1S/C24H21FN8O/c1-32-20(7-10-27-32)29-24-26-9-6-19(28-24)17-13-21-30-31-23-16(8-11-34-22(14-17)33(21)23)12-15-2-4-18(25)5-3-15/h2-7,9-10,13-14,16H,8,11-12H2,1H3,(H,26,28,29) |
| InChIKey | VJJWYAULXXNGLG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |