C23H20N8O — CID 118146097
4-(5-benzyl-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118146097) has the molecular formula C23H20N8O and a molecular weight of 424.47 g/mol. Its IUPAC name is 4-(5-benzyl-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-(5-benzyl-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118146097 |
| Molecular Formula | C23H20N8O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-(5-benzyl-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl)-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(Cc2ccccc2)CO3)n1 |
| InChI | InChI=1S/C23H20N8O/c1-30-19(8-10-25-30)27-23-24-9-7-18(26-23)16-12-20-28-29-22-17(11-15-5-3-2-4-6-15)14-32-21(13-16)31(20)22/h2-10,12-13,17H,11,14H2,1H3,(H,24,26,27) |
| InChIKey | UMMWPQCPEZFOCL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |