C23H19FN8O — CID 118146160
4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118146160) has the molecular formula C23H19FN8O and a molecular weight of 442.46 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118146160 |
| Molecular Formula | C23H19FN8O |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(Cc2ccc(F)cc2)CO3)n1 |
| InChI | InChI=1S/C23H19FN8O/c1-31-19(7-9-26-31)28-23-25-8-6-18(27-23)15-11-20-29-30-22-16(13-33-21(12-15)32(20)22)10-14-2-4-17(24)5-3-14/h2-9,11-12,16H,10,13H2,1H3,(H,25,27,28) |
| InChIKey | LKPURUXMGAYBBU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |