C24H22N8O2 — CID 118146191
4-[5-[(3-methoxyphenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118146191) has the molecular formula C24H22N8O2 and a molecular weight of 454.49 g/mol. Its IUPAC name is 4-[5-[(3-methoxyphenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-[5-[(3-methoxyphenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118146191 |
| Molecular Formula | C24H22N8O2 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 4-[5-[(3-methoxyphenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | COc1cccc(CC2COc3cc(-c4ccnc(Nc5ccnn5C)n4)cc4nnc2n34)c1 |
| InChI | InChI=1S/C24H22N8O2/c1-31-20(7-9-26-31)28-24-25-8-6-19(27-24)16-12-21-29-30-23-17(14-34-22(13-16)32(21)23)10-15-4-3-5-18(11-15)33-2/h3-9,11-13,17H,10,14H2,1-2H3,(H,25,27,28) |
| InChIKey | JFJIITBHEXVJRO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |