About (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide
(Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide (PubChem CID 118146193) has the molecular formula C15H23ClN2
and a molecular weight of 266.82 g/mol. Its IUPAC name is (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide |
| PubChem CID | 118146193 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide |
| SMILES | C=C/C=C\N=C(N)\C(=C(/C)CCCC)C(\Cl)=C/C |
| InChI | InChI=1S/C15H23ClN2/c1-5-8-10-12(4)14(13(16)7-3)15(17)18-11-9-6-2/h6-7,9,11H,2,5,8,10H2,1,3-4H3,(H2,17,18)/b11-9-,13-7+,14-12+ |
| InChIKey | GBYGSSYJIMYZDQ-DRZUBRJWSA-N |
| XLogP | 4.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide?
The IUPAC name of (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide (CID 118146193) is (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide.
What is the SMILES notation for (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide?
The canonical SMILES for (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide is C=C/C=C\N=C(N)\C(=C(/C)CCCC)C(\Cl)=C/C.
What is the InChIKey of (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide?
The InChIKey is GBYGSSYJIMYZDQ-DRZUBRJWSA-N. The full InChI is InChI=1S/C15H23ClN2/c1-5-8-10-12(4)14(13(16)7-3)15(17)18-11-9-6-2/h6-7,9,11H,2,5,8,10H2,1,3-4H3,(H2,17,18)/b11-9-,13-7+,14-12+.
What are the key properties of (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide?
(Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide has a molecular weight of 266.82 g/mol, XLogP of 4.69, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-[(1Z)-buta-1,3-dienyl]-2-[(E)-1-chloroprop-1-enyl]-3-methylhept-2-enimidamide is sourced from PubChem (CID 118146193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).