C23H18F2N8O — CID 118146222
4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine (PubChem CID 118146222) has the molecular formula C23H18F2N8O and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine.
| Compound Name | 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 118146222 |
| Molecular Formula | C23H18F2N8O |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyrimidin-2-amine |
| SMILES | Cn1nccc1Nc1nccc(-c2cc3n4c(nnc4c2)C(Cc2ccc(F)c(F)c2)CO3)n1 |
| InChI | InChI=1S/C23H18F2N8O/c1-32-19(5-7-27-32)29-23-26-6-4-18(28-23)14-10-20-30-31-22-15(12-34-21(11-14)33(20)22)8-13-2-3-16(24)17(25)9-13/h2-7,9-11,15H,8,12H2,1H3,(H,26,28,29) |
| InChIKey | RMHJNFWPWRSQPL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |