C24H19F2N7O — CID 118146223
4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 118146223) has the molecular formula C24H19F2N7O and a molecular weight of 459.46 g/mol. Its IUPAC name is 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 118146223 |
| Molecular Formula | C24H19F2N7O |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 4-[5-[(3,4-difluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | Cn1nccc1Nc1cc(-c2cc3n4c(nnc4c2)C(Cc2ccc(F)c(F)c2)CO3)ccn1 |
| InChI | InChI=1S/C24H19F2N7O/c1-32-21(5-7-28-32)29-20-10-15(4-6-27-20)16-11-22-30-31-24-17(13-34-23(12-16)33(22)24)8-14-2-3-18(25)19(26)9-14/h2-7,9-12,17H,8,13H2,1H3,(H,27,29) |
| InChIKey | PYDBGLJLPSFVOL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |