C18H32N2O — CID 118146494
(3E,5Z)-4,6-dimethyl-N-(1-morpholin-4-ylpropan-2-yl)nona-1,3,5-trien-5-amine (PubChem CID 118146494) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is (3E,5Z)-4,6-dimethyl-N-(1-morpholin-4-ylpropan-2-yl)nona-1,3,5-trien-5-amine.
| Compound Name | (3E,5Z)-4,6-dimethyl-N-(1-morpholin-4-ylpropan-2-yl)nona-1,3,5-trien-5-amine |
|---|---|
| PubChem CID | 118146494 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (3E,5Z)-4,6-dimethyl-N-(1-morpholin-4-ylpropan-2-yl)nona-1,3,5-trien-5-amine |
| SMILES | C=C/C=C(C)/C(NC(C)CN1CCOCC1)=C(\C)CCC |
| InChI | InChI=1S/C18H32N2O/c1-6-8-15(3)18(16(4)9-7-2)19-17(5)14-20-10-12-21-13-11-20/h6,8,17,19H,1,7,9-14H2,2-5H3/b15-8+,18-16- |
| InChIKey | LPXBSHQCYZMGRS-FJANHMTKSA-N |
| XLogP | 3.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|