C10H19NO2 — CID 118146686
(3-butoxy-1,2,3,6-tetrahydropyridin-2-yl)methanol (PubChem CID 118146686) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3-butoxy-1,2,3,6-tetrahydropyridin-2-yl)methanol.
| Compound Name | (3-butoxy-1,2,3,6-tetrahydropyridin-2-yl)methanol |
|---|---|
| PubChem CID | 118146686 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3-butoxy-1,2,3,6-tetrahydropyridin-2-yl)methanol |
| SMILES | CCCCOC1C=CCNC1CO |
| InChI | InChI=1S/C10H19NO2/c1-2-3-7-13-10-5-4-6-11-9(10)8-12/h4-5,9-12H,2-3,6-8H2,1H3 |
| InChIKey | IUWYRWAQXUOBIP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|