About 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea
1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea (PubChem CID 118146817) has the molecular formula C17H24N6O2
and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea.
Molecular Properties
| Compound Name | 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea |
| PubChem CID | 118146817 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC1CCC(Nc2ncc3ccc(=O)[nH]c3n2)CC1 |
| InChI | InChI=1S/C17H24N6O2/c1-10(2)19-17(25)21-13-6-4-12(5-7-13)20-16-18-9-11-3-8-14(24)22-15(11)23-16/h3,8-10,12-13H,4-7H2,1-2H3,(H2,19,21,25)(H2,18,20,22,23,24) |
| InChIKey | ZERPCBZTDATMJJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea?
The IUPAC name of 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea (CID 118146817) is 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea.
What is the SMILES notation for 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea?
The canonical SMILES for 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea is CC(C)NC(=O)NC1CCC(Nc2ncc3ccc(=O)[nH]c3n2)CC1.
What is the InChIKey of 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea?
The InChIKey is ZERPCBZTDATMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O2/c1-10(2)19-17(25)21-13-6-4-12(5-7-13)20-16-18-9-11-3-8-14(24)22-15(11)23-16/h3,8-10,12-13H,4-7H2,1-2H3,(H2,19,21,25)(H2,18,20,22,23,24).
What are the key properties of 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea?
1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea has a molecular weight of 344.42 g/mol, XLogP of 1.75, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl)amino]cyclohexyl]-3-propan-2-ylurea is sourced from PubChem (CID 118146817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).