C22H23BrFNO7 — CID 118147354
benzyl [(1Z,2R,4S)-4-bromo-2-fluoro-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate (PubChem CID 118147354) has the molecular formula C22H23BrFNO7 and a molecular weight of 512.33 g/mol. Its IUPAC name is benzyl [(1Z,2R,4S)-4-bromo-2-fluoro-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate.
| Compound Name | benzyl [(1Z,2R,4S)-4-bromo-2-fluoro-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate |
|---|---|
| PubChem CID | 118147354 |
| Molecular Formula | C22H23BrFNO7 |
| Molecular Weight | 512.33 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | benzyl [(1Z,2R,4S)-4-bromo-2-fluoro-1-methoxyimino-5-phenylmethoxycarbonyloxypentan-3-yl] carbonate |
| SMILES | CO/N=C\[C@@H](F)C(OC(=O)OCc1ccccc1)[C@@H](Br)COC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23BrFNO7/c1-28-25-12-19(24)20(32-22(27)30-14-17-10-6-3-7-11-17)18(23)15-31-21(26)29-13-16-8-4-2-5-9-16/h2-12,18-20H,13-15H2,1H3/b25-12-/t18-,19+,20?/m0/s1 |
| InChIKey | XIMLYBJOLMPVSO-ZEEMSEERSA-N |
| XLogP | 4.80 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|