C14H22FN3O5 — CID 118147404
pentyl N-[1-[(1R)-1-ethoxy-2-hydroxyethyl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate (PubChem CID 118147404) has the molecular formula C14H22FN3O5 and a molecular weight of 331.34 g/mol. Its IUPAC name is pentyl N-[1-[(1R)-1-ethoxy-2-hydroxyethyl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[1-[(1R)-1-ethoxy-2-hydroxyethyl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 118147404 |
| Molecular Formula | C14H22FN3O5 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | pentyl N-[1-[(1R)-1-ethoxy-2-hydroxyethyl]-5-fluoro-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H](CO)OCC)cc1F |
| InChI | InChI=1S/C14H22FN3O5/c1-3-5-6-7-23-14(21)17-12-10(15)8-18(13(20)16-12)11(9-19)22-4-2/h8,11,19H,3-7,9H2,1-2H3,(H,16,17,20,21)/t11-/m1/s1 |
| InChIKey | PDMOBHZRPZXFPZ-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|