C36H28BF20N — CID 11814877
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium (PubChem CID 11814877) has the molecular formula C36H28BF20N and a molecular weight of 865.40 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium |
|---|---|
| PubChem CID | 11814877 |
| Molecular Formula | C36H28BF20N |
| Molecular Weight | 865.40 g/mol |
| Exact Mass | 865.20 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium |
| SMILES | CCCC[NH+](CCCC)CCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C12H27N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-4-7-10-13(11-8-5-2)12-9-6-3/h;4-12H2,1-3H3/q-1;/p+1 |
| InChIKey | PKOLCPGOUTYGFF-UHFFFAOYSA-O |
| XLogP | 8.12 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.40 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|