C52H29F4N3O — CID 118149553
9-(4-dibenzofuran-4-ylphenyl)-6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,2,3,4-tetrafluorocarbazole (PubChem CID 118149553) has the molecular formula C52H29F4N3O and a molecular weight of 787.82 g/mol. Its IUPAC name is 9-(4-dibenzofuran-4-ylphenyl)-6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,2,3,4-tetrafluorocarbazole.
| Compound Name | 9-(4-dibenzofuran-4-ylphenyl)-6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,2,3,4-tetrafluorocarbazole |
|---|---|
| PubChem CID | 118149553 |
| Molecular Formula | C52H29F4N3O |
| Molecular Weight | 787.82 g/mol |
| Exact Mass | 787.22 |
| IUPAC Name | 9-(4-dibenzofuran-4-ylphenyl)-6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-1,2,3,4-tetrafluorocarbazole |
| SMILES | Fc1c(F)c(F)c2c(c1F)c1cc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc1n2-c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C52H29F4N3O/c53-46-45-40-28-34(33-15-9-16-35(27-33)42-29-41(31-11-3-1-4-12-31)57-52(58-42)32-13-5-2-6-14-32)23-26-43(40)59(50(45)49(56)48(55)47(46)54)36-24-21-30(22-25-36)37-18-10-19-39-38-17-7-8-20-44(38)60-51(37)39/h1-29H |
| InChIKey | KQJRZOWYLCMWOT-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.82 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|