C53H34N2O — CID 118149555
3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)carbazole (PubChem CID 118149555) has the molecular formula C53H34N2O and a molecular weight of 718.89 g/mol. Its IUPAC name is 3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)carbazole.
| Compound Name | 3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)carbazole |
|---|---|
| PubChem CID | 118149555 |
| Molecular Formula | C53H34N2O |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.29 |
| IUPAC Name | 3-[3-(4,6-diphenyl-2-pyridinyl)phenyl]-9-(2,3,5,6-tetradeuterio-4-dibenzofuran-4-ylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c(-n2c3ccccc3c3cc(-c4cccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)n5)c4)ccc32)c([2H])c([2H])c1-c1cccc2c1oc1ccccc12 |
| InChI | InChI=1S/C53H34N2O/c1-3-13-35(14-4-1)41-33-48(37-15-5-2-6-16-37)54-49(34-41)40-18-11-17-38(31-40)39-27-30-51-47(32-39)44-19-7-9-23-50(44)55(51)42-28-25-36(26-29-42)43-21-12-22-46-45-20-8-10-24-52(45)56-53(43)46/h1-34H/i25D,26D,28D,29D |
| InChIKey | GESCIWYAZCOQCC-KJVZXISESA-N |
| XLogP | 14.41 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |