About benzyl 1-propan-2-yloxyethyl carbonate
benzyl 1-propan-2-yloxyethyl carbonate (PubChem CID 118149586) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is benzyl 1-propan-2-yloxyethyl carbonate.
Molecular Properties
| Compound Name | benzyl 1-propan-2-yloxyethyl carbonate |
| PubChem CID | 118149586 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | benzyl 1-propan-2-yloxyethyl carbonate |
| SMILES | CC(C)OC(C)OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H18O4/c1-10(2)16-11(3)17-13(14)15-9-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | PQRXGLLUFHIIMO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze benzyl 1-propan-2-yloxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1-propan-2-yloxyethyl carbonate?
The IUPAC name of benzyl 1-propan-2-yloxyethyl carbonate (CID 118149586) is benzyl 1-propan-2-yloxyethyl carbonate.
What is the SMILES notation for benzyl 1-propan-2-yloxyethyl carbonate?
The canonical SMILES for benzyl 1-propan-2-yloxyethyl carbonate is CC(C)OC(C)OC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 1-propan-2-yloxyethyl carbonate?
The InChIKey is PQRXGLLUFHIIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-10(2)16-11(3)17-13(14)15-9-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3.
What are the key properties of benzyl 1-propan-2-yloxyethyl carbonate?
benzyl 1-propan-2-yloxyethyl carbonate has a molecular weight of 238.28 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1-propan-2-yloxyethyl carbonate is sourced from PubChem (CID 118149586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).