About 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone
1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone (PubChem CID 118149914) has the molecular formula C21H17NO2S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone |
| PubChem CID | 118149914 |
| Molecular Formula | C21H17NO2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1sccc1-c1ccc(C2=Nc3ccc(C)cc3OC2)cc1 |
| InChI | InChI=1S/C21H17NO2S/c1-13-3-8-18-20(11-13)24-12-19(22-18)16-6-4-15(5-7-16)17-9-10-25-21(17)14(2)23/h3-11H,12H2,1-2H3 |
| InChIKey | SPWWQCQRJRJOKQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone?
The IUPAC name of 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone (CID 118149914) is 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone.
What is the SMILES notation for 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone?
The canonical SMILES for 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone is CC(=O)c1sccc1-c1ccc(C2=Nc3ccc(C)cc3OC2)cc1.
What is the InChIKey of 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone?
The InChIKey is SPWWQCQRJRJOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2S/c1-13-3-8-18-20(11-13)24-12-19(22-18)16-6-4-15(5-7-16)17-9-10-25-21(17)14(2)23/h3-11H,12H2,1-2H3.
What are the key properties of 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone?
1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone has a molecular weight of 347.44 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[4-(7-methyl-2H-1,4-benzoxazin-3-yl)phenyl]thiophen-2-yl]ethanone is sourced from PubChem (CID 118149914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).