About indene-1,3-dione
indene-1,3-dione (PubChem CID 11815) has the molecular formula C9H6O2
and a molecular weight of 146.14 g/mol. Its IUPAC name is indene-1,3-dione.
Molecular Properties
| Compound Name | indene-1,3-dione |
| PubChem CID | 11815 |
| Molecular Formula | C9H6O2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | indene-1,3-dione |
| SMILES | O=C1CC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | UHKAJLSKXBADFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze indene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indene-1,3-dione?
The IUPAC name of indene-1,3-dione (CID 11815) is indene-1,3-dione.
What is the SMILES notation for indene-1,3-dione?
The canonical SMILES for indene-1,3-dione is O=C1CC(=O)c2ccccc21.
What is the InChIKey of indene-1,3-dione?
The InChIKey is UHKAJLSKXBADFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2/c10-8-5-9(11)7-4-2-1-3-6(7)8/h1-4H,5H2.
What are the key properties of indene-1,3-dione?
indene-1,3-dione has a molecular weight of 146.14 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indene-1,3-dione is sourced from PubChem (CID 11815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).