C26H28F3N5O — CID 118150186
1-[(3S,4S,5S)-5-methyl-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-(2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)urea (PubChem CID 118150186) has the molecular formula C26H28F3N5O and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-[(3S,4S,5S)-5-methyl-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-(2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)urea.
| Compound Name | 1-[(3S,4S,5S)-5-methyl-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-(2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 118150186 |
| Molecular Formula | C26H28F3N5O |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 1-[(3S,4S,5S)-5-methyl-4-phenyl-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-3-(2-phenyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)urea |
| SMILES | C[C@H]1[C@@H](c2ccccc2)[C@H](NC(=O)Nc2c3c(nn2-c2ccccc2)CCC3)CN1CC(F)(F)F |
| InChI | InChI=1S/C26H28F3N5O/c1-17-23(18-9-4-2-5-10-18)22(15-33(17)16-26(27,28)29)30-25(35)31-24-20-13-8-14-21(20)32-34(24)19-11-6-3-7-12-19/h2-7,9-12,17,22-23H,8,13-16H2,1H3,(H2,30,31,35)/t17-,22+,23-/m0/s1 |
| InChIKey | QXSXJPDMIRPOPU-IMRHEYAYSA-N |
| XLogP | 4.90 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |