About (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal
(E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal (PubChem CID 118150450) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal.
Molecular Properties
| Compound Name | (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal |
| PubChem CID | 118150450 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal |
| SMILES | Cc1cc2ccc(CCNCc3ccc(/C=C/C=O)cc3)cc2n1C |
| InChI | InChI=1S/C22H24N2O/c1-17-14-21-10-9-19(15-22(21)24(17)2)11-12-23-16-20-7-5-18(6-8-20)4-3-13-25/h3-10,13-15,23H,11-12,16H2,1-2H3/b4-3+ |
| InChIKey | HDQJKVXPWHMQMP-ONEGZZNKSA-N |
| XLogP | 4.03 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal?
The IUPAC name of (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal (CID 118150450) is (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal.
What is the SMILES notation for (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal?
The canonical SMILES for (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal is Cc1cc2ccc(CCNCc3ccc(/C=C/C=O)cc3)cc2n1C.
What is the InChIKey of (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal?
The InChIKey is HDQJKVXPWHMQMP-ONEGZZNKSA-N. The full InChI is InChI=1S/C22H24N2O/c1-17-14-21-10-9-19(15-22(21)24(17)2)11-12-23-16-20-7-5-18(6-8-20)4-3-13-25/h3-10,13-15,23H,11-12,16H2,1-2H3/b4-3+.
What are the key properties of (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal?
(E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal has a molecular weight of 332.45 g/mol, XLogP of 4.03, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-[[2-(1,2-dimethylindol-6-yl)ethylamino]methyl]phenyl]prop-2-enal is sourced from PubChem (CID 118150450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).