C23H18N2O6S2 — CID 1181505
N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide (PubChem CID 1181505) has the molecular formula C23H18N2O6S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1181505 |
| Molecular Formula | C23H18N2O6S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | N-[3-(benzenesulfonamido)-4-oxonaphthalen-1-ylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N=C2C=C(NS(=O)(=O)c3ccccc3)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18N2O6S2/c1-31-16-11-13-18(14-12-16)33(29,30)24-21-15-22(23(26)20-10-6-5-9-19(20)21)25-32(27,28)17-7-3-2-4-8-17/h2-15,25H,1H3 |
| InChIKey | YWYJUYMGMGBZPD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|