About 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol
2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol (PubChem CID 118150779) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol |
| PubChem CID | 118150779 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol |
| SMILES | CO/C(=C/C=C/N)CNCCO |
| InChI | InChI=1S/C8H16N2O2/c1-12-8(3-2-4-9)7-10-5-6-11/h2-4,10-11H,5-7,9H2,1H3/b4-2+,8-3+ |
| InChIKey | OYHXOFAUGSEKFV-BVOBWIRXSA-N |
| XLogP | -0.43 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol?
The IUPAC name of 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol (CID 118150779) is 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol.
What is the SMILES notation for 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol?
The canonical SMILES for 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol is CO/C(=C/C=C/N)CNCCO.
What is the InChIKey of 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol?
The InChIKey is OYHXOFAUGSEKFV-BVOBWIRXSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-12-8(3-2-4-9)7-10-5-6-11/h2-4,10-11H,5-7,9H2,1H3/b4-2+,8-3+.
What are the key properties of 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol?
2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol has a molecular weight of 172.23 g/mol, XLogP of -0.43, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2E,4E)-5-amino-2-methoxypenta-2,4-dienyl]amino]ethanol is sourced from PubChem (CID 118150779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).