C11H11F7N2O3 — CID 118150792
ethyl 5-(difluoromethoxy)-1-(3,3,4,4,4-pentafluorobutyl)pyrazole-3-carboxylate (PubChem CID 118150792) has the molecular formula C11H11F7N2O3 and a molecular weight of 352.21 g/mol. Its IUPAC name is ethyl 5-(difluoromethoxy)-1-(3,3,4,4,4-pentafluorobutyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(difluoromethoxy)-1-(3,3,4,4,4-pentafluorobutyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 118150792 |
| Molecular Formula | C11H11F7N2O3 |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | ethyl 5-(difluoromethoxy)-1-(3,3,4,4,4-pentafluorobutyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(OC(F)F)n(CCC(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H11F7N2O3/c1-2-22-8(21)6-5-7(23-9(12)13)20(19-6)4-3-10(14,15)11(16,17)18/h5,9H,2-4H2,1H3 |
| InChIKey | XCTJMVXWSFLOIT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|