C12H13BrN2O6 — CID 118151469
[(2S,3R)-4-(6-bromo-1H-benzimidazol-2-yl)-1,2,3,4-tetrahydroxybutyl] formate (PubChem CID 118151469) has the molecular formula C12H13BrN2O6 and a molecular weight of 361.15 g/mol. Its IUPAC name is [(2S,3R)-4-(6-bromo-1H-benzimidazol-2-yl)-1,2,3,4-tetrahydroxybutyl] formate.
| Compound Name | [(2S,3R)-4-(6-bromo-1H-benzimidazol-2-yl)-1,2,3,4-tetrahydroxybutyl] formate |
|---|---|
| PubChem CID | 118151469 |
| Molecular Formula | C12H13BrN2O6 |
| Molecular Weight | 361.15 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | [(2S,3R)-4-(6-bromo-1H-benzimidazol-2-yl)-1,2,3,4-tetrahydroxybutyl] formate |
| SMILES | O=COC(O)[C@@H](O)[C@H](O)C(O)c1nc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C12H13BrN2O6/c13-5-1-2-6-7(3-5)15-11(14-6)9(18)8(17)10(19)12(20)21-4-16/h1-4,8-10,12,17-20H,(H,14,15)/t8-,9?,10+,12?/m1/s1 |
| InChIKey | QRBDDTFLIWUOGH-HUXNSBQSSA-N |
| XLogP | -0.43 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|