About methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate
methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate (PubChem CID 118151803) has the molecular formula C16H19ClO4
and a molecular weight of 310.78 g/mol. Its IUPAC name is methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate.
Molecular Properties
| Compound Name | methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate |
| PubChem CID | 118151803 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate |
| SMILES | COC(=O)[C@H]1OC2(CCCCC2)O[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClO4/c1-19-15(18)14-13(11-7-3-4-8-12(11)17)20-16(21-14)9-5-2-6-10-16/h3-4,7-8,13-14H,2,5-6,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | PKIHMXNDXQQKLV-KGLIPLIRSA-N |
| XLogP | 3.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate?
The IUPAC name of methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate (CID 118151803) is methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate.
What is the SMILES notation for methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate?
The canonical SMILES for methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate is COC(=O)[C@H]1OC2(CCCCC2)O[C@@H]1c1ccccc1Cl.
What is the InChIKey of methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate?
The InChIKey is PKIHMXNDXQQKLV-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H19ClO4/c1-19-15(18)14-13(11-7-3-4-8-12(11)17)20-16(21-14)9-5-2-6-10-16/h3-4,7-8,13-14H,2,5-6,9-10H2,1H3/t13-,14+/m1/s1.
What are the key properties of methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate?
methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate has a molecular weight of 310.78 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3S)-2-(2-chlorophenyl)-1,4-dioxaspiro[4.5]decane-3-carboxylate is sourced from PubChem (CID 118151803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).