About 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one
1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one (PubChem CID 118152186) has the molecular formula C11H13NO5
and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one |
| PubChem CID | 118152186 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(O)c(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13NO5/c1-11(2,3)10(15)6-4-8(13)9(14)5-7(6)12(16)17/h4-5,13-14H,1-3H3 |
| InChIKey | LZWXOKMAQWJNND-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one (CID 118152186) is 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one is CC(C)(C)C(=O)c1cc(O)c(O)cc1[N+](=O)[O-].
What is the InChIKey of 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one?
The InChIKey is LZWXOKMAQWJNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c1-11(2,3)10(15)6-4-8(13)9(14)5-7(6)12(16)17/h4-5,13-14H,1-3H3.
What are the key properties of 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one?
1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one has a molecular weight of 239.23 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydroxy-2-nitrophenyl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 118152186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).