About (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene
(1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene (PubChem CID 118152226) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene.
Molecular Properties
| Compound Name | (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene |
| PubChem CID | 118152226 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene |
| SMILES | C=C/C=C(\C=C/N=O)OC |
| InChI | InChI=1S/C7H9NO2/c1-3-4-7(10-2)5-6-8-9/h3-6H,1H2,2H3/b6-5-,7-4+ |
| InChIKey | UITPDFVFEKUKBD-IUQJDUBZSA-N |
| XLogP | 1.98 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene?
The IUPAC name of (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene (CID 118152226) is (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene.
What is the SMILES notation for (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene?
The canonical SMILES for (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene is C=C/C=C(\C=C/N=O)OC.
What is the InChIKey of (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene?
The InChIKey is UITPDFVFEKUKBD-IUQJDUBZSA-N. The full InChI is InChI=1S/C7H9NO2/c1-3-4-7(10-2)5-6-8-9/h3-6H,1H2,2H3/b6-5-,7-4+.
What are the key properties of (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene?
(1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene has a molecular weight of 139.15 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-3-methoxy-1-nitrosohexa-1,3,5-triene is sourced from PubChem (CID 118152226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).