C26H44FNO5 — CID 118152314
6-butoxy-3-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-2-fluoropyridine (PubChem CID 118152314) has the molecular formula C26H44FNO5 and a molecular weight of 469.64 g/mol. Its IUPAC name is 6-butoxy-3-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-2-fluoropyridine.
| Compound Name | 6-butoxy-3-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 118152314 |
| Molecular Formula | C26H44FNO5 |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 6-butoxy-3-[(2S,3R,5R)-3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]-2-fluoropyridine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2ccc(OCCCC)nc2F)[C@@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C26H44FNO5/c1-5-9-15-29-19-21-24(31-17-11-7-3)25(32-18-12-8-4)23(33-21)20-13-14-22(28-26(20)27)30-16-10-6-2/h13-14,21,23-25H,5-12,15-19H2,1-4H3/t21-,23+,24?,25-/m1/s1 |
| InChIKey | ZDIKXFMXWDNGND-AMXQZFSZSA-N |
| XLogP | 6.03 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|