C8H14F3N5O — CID 118153094
N-[N'-[(Z)-4,4,4-trifluoro-3-(2-methylhydrazinyl)but-2-enyl]carbamimidoyl]acetamide (PubChem CID 118153094) has the molecular formula C8H14F3N5O and a molecular weight of 253.23 g/mol. Its IUPAC name is N-[N'-[(Z)-4,4,4-trifluoro-3-(2-methylhydrazinyl)but-2-enyl]carbamimidoyl]acetamide.
| Compound Name | N-[N'-[(Z)-4,4,4-trifluoro-3-(2-methylhydrazinyl)but-2-enyl]carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 118153094 |
| Molecular Formula | C8H14F3N5O |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-[N'-[(Z)-4,4,4-trifluoro-3-(2-methylhydrazinyl)but-2-enyl]carbamimidoyl]acetamide |
| SMILES | CNN/C(=C\C/N=C(\N)NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N5O/c1-5(17)15-7(12)14-4-3-6(16-13-2)8(9,10)11/h3,13,16H,4H2,1-2H3,(H3,12,14,15,17)/b6-3- |
| InChIKey | XCTJMSYXSXMLQG-UTCJRWHESA-N |
| XLogP | -0.39 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|