C11H16F2 — CID 118153241
(3E,5E)-3-(1,1-difluoroethyl)-6-methylocta-1,3,5-triene (PubChem CID 118153241) has the molecular formula C11H16F2 and a molecular weight of 186.24 g/mol. Its IUPAC name is (3E,5E)-3-(1,1-difluoroethyl)-6-methylocta-1,3,5-triene.
| Compound Name | (3E,5E)-3-(1,1-difluoroethyl)-6-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 118153241 |
| Molecular Formula | C11H16F2 |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (3E,5E)-3-(1,1-difluoroethyl)-6-methylocta-1,3,5-triene |
| SMILES | C=C/C(=C\C=C(/C)CC)C(C)(F)F |
| InChI | InChI=1S/C11H16F2/c1-5-9(3)7-8-10(6-2)11(4,12)13/h6-8H,2,5H2,1,3-4H3/b9-7+,10-8+ |
| InChIKey | TUFRIKXPKMAMRW-FIFLTTCUSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|