C23H18ClF2N3O3 — CID 118153345
5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-6-methyl-1H-pyridin-2-one (PubChem CID 118153345) has the molecular formula C23H18ClF2N3O3 and a molecular weight of 457.86 g/mol. Its IUPAC name is 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-6-methyl-1H-pyridin-2-one.
| Compound Name | 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-6-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118153345 |
| Molecular Formula | C23H18ClF2N3O3 |
| Molecular Weight | 457.86 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 5-[(3R,5R)-3-[5-chloro-2-(difluoromethoxy)phenyl]-5-hydroxy-1,7-diazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraen-11-yl]-6-methyl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)ccc1-c1ccc2nc3c(n2c1)[C@@H](c1cc(Cl)ccc1OC(F)F)C[C@H]3O |
| InChI | InChI=1S/C23H18ClF2N3O3/c1-11-14(4-7-20(31)27-11)12-2-6-19-28-21-17(30)9-16(22(21)29(19)10-12)15-8-13(24)3-5-18(15)32-23(25)26/h2-8,10,16-17,23,30H,9H2,1H3,(H,27,31)/t16-,17-/m1/s1 |
| InChIKey | IHVWZPQWFLJLOD-IAGOWNOFSA-N |
| XLogP | 4.82 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.86 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |